C10H13F2NO — CID 178011639
N-[(E)-but-2-enyl]-2,2-difluorospiro[2.2]pentane-1-carboxamide (PubChem CID 178011639) has the molecular formula C10H13F2NO and a molecular weight of 201.22 g/mol. Its IUPAC name is N-[(E)-but-2-enyl]-2,2-difluorospiro[2.2]pentane-1-carboxamide.
| Compound Name | N-[(E)-but-2-enyl]-2,2-difluorospiro[2.2]pentane-1-carboxamide |
|---|---|
| PubChem CID | 178011639 |
| Molecular Formula | C10H13F2NO |
| Molecular Weight | 201.22 g/mol |
| Exact Mass | 201.10 |
| IUPAC Name | N-[(E)-but-2-enyl]-2,2-difluorospiro[2.2]pentane-1-carboxamide |
| SMILES | C/C=C/CNC(=O)C1C(F)(F)C12CC2 |
| InChI | InChI=1S/C10H13F2NO/c1-2-3-6-13-8(14)7-9(4-5-9)10(7,11)12/h2-3,7H,4-6H2,1H3,(H,13,14)/b3-2+ |
| InChIKey | IHGWZMTVVBEXDY-NSCUHMNNSA-N |
| XLogP | 1.72 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.22 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|