C14H13FNOP — CID 142980732
9-fluoro-6-methyl-4,11-dihydrophosphinolino[3,2-b]azepin-11-ol (PubChem CID 142980732) has the molecular formula C14H13FNOP and a molecular weight of 261.24 g/mol. Its IUPAC name is 9-fluoro-6-methyl-4,11-dihydrophosphinolino[3,2-b]azepin-11-ol.
| Compound Name | 9-fluoro-6-methyl-4,11-dihydrophosphinolino[3,2-b]azepin-11-ol |
|---|---|
| PubChem CID | 142980732 |
| Molecular Formula | C14H13FNOP |
| Molecular Weight | 261.24 g/mol |
| Exact Mass | 261.07 |
| IUPAC Name | 9-fluoro-6-methyl-4,11-dihydrophosphinolino[3,2-b]azepin-11-ol |
| SMILES | CP1C2=CCC=CN=C2C(O)c2cc(F)ccc21 |
| InChI | InChI=1S/C14H13FNOP/c1-18-11-6-5-9(15)8-10(11)14(17)13-12(18)4-2-3-7-16-13/h3-8,14,17H,2H2,1H3 |
| InChIKey | AIDSRVJZNZNQRJ-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 32.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.24 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|