C14H15FNO+ — CID 159012561
(R)-3,4-dihydropyrrol-4-ylium-2-yl-(4-fluoro-2-propylphenyl)methanol (PubChem CID 159012561) has the molecular formula C14H15FNO+ and a molecular weight of 232.28 g/mol. Its IUPAC name is (R)-3,4-dihydropyrrol-4-ylium-2-yl-(4-fluoro-2-propylphenyl)methanol.
| Compound Name | (R)-3,4-dihydropyrrol-4-ylium-2-yl-(4-fluoro-2-propylphenyl)methanol |
|---|---|
| PubChem CID | 159012561 |
| Molecular Formula | C14H15FNO+ |
| Molecular Weight | 232.28 g/mol |
| Exact Mass | 232.11 |
| IUPAC Name | (R)-3,4-dihydropyrrol-4-ylium-2-yl-(4-fluoro-2-propylphenyl)methanol |
| SMILES | CCCc1cc(F)ccc1[C@@H](O)C1=NC=[C+]C1 |
| InChI | InChI=1S/C14H15FNO/c1-2-4-10-9-11(15)6-7-12(10)14(17)13-5-3-8-16-13/h6-9,14,17H,2,4-5H2,1H3/q+1/t14-/m1/s1 |
| InChIKey | DNOVWXXBGVGTAT-CQSZACIVSA-N |
| XLogP | 2.97 |
| TPSA | 32.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.28 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|