C25H30N4OS — CID 142981824
ethane;2-methoxy-3-[5-[(4-sulfanylpiperazin-1-yl)methyl]-1H-indol-2-yl]quinoline (PubChem CID 142981824) has the molecular formula C25H30N4OS and a molecular weight of 434.61 g/mol. Its IUPAC name is ethane;2-methoxy-3-[5-[(4-sulfanylpiperazin-1-yl)methyl]-1H-indol-2-yl]quinoline.
| Compound Name | ethane;2-methoxy-3-[5-[(4-sulfanylpiperazin-1-yl)methyl]-1H-indol-2-yl]quinoline |
|---|---|
| PubChem CID | 142981824 |
| Molecular Formula | C25H30N4OS |
| Molecular Weight | 434.61 g/mol |
| Exact Mass | 434.21 |
| IUPAC Name | ethane;2-methoxy-3-[5-[(4-sulfanylpiperazin-1-yl)methyl]-1H-indol-2-yl]quinoline |
| SMILES | CC.COc1nc2ccccc2cc1-c1cc2cc(CN3CCN(S)CC3)ccc2[nH]1 |
| InChI | InChI=1S/C23H24N4OS.C2H6/c1-28-23-19(13-17-4-2-3-5-20(17)25-23)22-14-18-12-16(6-7-21(18)24-22)15-26-8-10-27(29)11-9-26;1-2/h2-7,12-14,24,29H,8-11,15H2,1H3;1-2H3 |
| InChIKey | OJTLSFKEQPRLQW-UHFFFAOYSA-N |
| XLogP | 5.38 |
| TPSA | 44.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.61 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|