C16H22ClN3 — CID 142985930
2-chloro-N-methylquinazolin-4-amine;methylcyclohexane (PubChem CID 142985930) has the molecular formula C16H22ClN3 and a molecular weight of 291.83 g/mol. Its IUPAC name is 2-chloro-N-methylquinazolin-4-amine;methylcyclohexane.
| Compound Name | 2-chloro-N-methylquinazolin-4-amine;methylcyclohexane |
|---|---|
| PubChem CID | 142985930 |
| Molecular Formula | C16H22ClN3 |
| Molecular Weight | 291.83 g/mol |
| Exact Mass | 291.15 |
| IUPAC Name | 2-chloro-N-methylquinazolin-4-amine;methylcyclohexane |
| SMILES | CC1CCCCC1.CNc1nc(Cl)nc2ccccc12 |
| InChI | InChI=1S/C9H8ClN3.C7H14/c1-11-8-6-4-2-3-5-7(6)12-9(10)13-8;1-7-5-3-2-4-6-7/h2-5H,1H3,(H,11,12,13);7H,2-6H2,1H3 |
| InChIKey | IYKDDZGIDVDOBG-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.83 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |