About 2-chloro-N-methylquinazolin-4-amine;methylcyclohexane
2-chloro-N-methylquinazolin-4-amine;methylcyclohexane (PubChem CID 142985930) has the molecular formula C16H22ClN3
and a molecular weight of 291.83 g/mol. Its IUPAC name is 2-chloro-N-methylquinazolin-4-amine;methylcyclohexane.
Molecular Properties
| Compound Name | 2-chloro-N-methylquinazolin-4-amine;methylcyclohexane |
| PubChem CID | 142985930 |
| Molecular Formula | C16H22ClN3 |
| Molecular Weight | 291.83 g/mol |
| Exact Mass | 291.15 |
| IUPAC Name | 2-chloro-N-methylquinazolin-4-amine;methylcyclohexane |
| SMILES | CC1CCCCC1.CNc1nc(Cl)nc2ccccc12 |
| InChI | InChI=1S/C9H8ClN3.C7H14/c1-11-8-6-4-2-3-5-7(6)12-9(10)13-8;1-7-5-3-2-4-6-7/h2-5H,1H3,(H,11,12,13);7H,2-6H2,1H3 |
| InChIKey | IYKDDZGIDVDOBG-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 291.83 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-chloro-N-methylquinazolin-4-amine;methylcyclohexane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-chloro-N-methylquinazolin-4-amine;methylcyclohexane?
The IUPAC name of 2-chloro-N-methylquinazolin-4-amine;methylcyclohexane (CID 142985930) is 2-chloro-N-methylquinazolin-4-amine;methylcyclohexane.
What is the SMILES notation for 2-chloro-N-methylquinazolin-4-amine;methylcyclohexane?
The canonical SMILES for 2-chloro-N-methylquinazolin-4-amine;methylcyclohexane is CC1CCCCC1.CNc1nc(Cl)nc2ccccc12.
What is the InChIKey of 2-chloro-N-methylquinazolin-4-amine;methylcyclohexane?
The InChIKey is IYKDDZGIDVDOBG-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H8ClN3.C7H14/c1-11-8-6-4-2-3-5-7(6)12-9(10)13-8;1-7-5-3-2-4-6-7/h2-5H,1H3,(H,11,12,13);7H,2-6H2,1H3.
What are the key properties of 2-chloro-N-methylquinazolin-4-amine;methylcyclohexane?
2-chloro-N-methylquinazolin-4-amine;methylcyclohexane has a molecular weight of 291.83 g/mol, XLogP of 4.91, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-chloro-N-methylquinazolin-4-amine;methylcyclohexane is sourced from PubChem (CID 142985930), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).