C12H14N2O3 — CID 14298609
4-quinoxalin-2-ylbutane-1,2,3-triol (PubChem CID 14298609) has the molecular formula C12H14N2O3 and a molecular weight of 234.25 g/mol. Its IUPAC name is 4-quinoxalin-2-ylbutane-1,2,3-triol.
| Compound Name | 4-quinoxalin-2-ylbutane-1,2,3-triol |
|---|---|
| PubChem CID | 14298609 |
| Molecular Formula | C12H14N2O3 |
| Molecular Weight | 234.25 g/mol |
| Exact Mass | 234.10 |
| IUPAC Name | 4-quinoxalin-2-ylbutane-1,2,3-triol |
| SMILES | OCC(O)C(O)Cc1cnc2ccccc2n1 |
| InChI | InChI=1S/C12H14N2O3/c15-7-12(17)11(16)5-8-6-13-9-3-1-2-4-10(9)14-8/h1-4,6,11-12,15-17H,5,7H2 |
| InChIKey | KFKHJQAEESRVHL-UHFFFAOYSA-N |
| XLogP | -0.11 |
| TPSA | 86.47 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.25 |
| LogP ≤ 5 | -0.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |