C23H40O — CID 142986178
ethane;[(Z,2Z)-4-ethyl-3-methoxy-2-propylidenehept-3-enyl]benzene (PubChem CID 142986178) has the molecular formula C23H40O and a molecular weight of 332.57 g/mol. Its IUPAC name is ethane;[(Z,2Z)-4-ethyl-3-methoxy-2-propylidenehept-3-enyl]benzene.
| Compound Name | ethane;[(Z,2Z)-4-ethyl-3-methoxy-2-propylidenehept-3-enyl]benzene |
|---|---|
| PubChem CID | 142986178 |
| Molecular Formula | C23H40O |
| Molecular Weight | 332.57 g/mol |
| Exact Mass | 332.31 |
| IUPAC Name | ethane;[(Z,2Z)-4-ethyl-3-methoxy-2-propylidenehept-3-enyl]benzene |
| SMILES | CC.CC.CC/C=C(Cc1ccccc1)\C(OC)=C(/CC)CCC |
| InChI | InChI=1S/C19H28O.2C2H6/c1-5-11-17(7-3)19(20-4)18(12-6-2)15-16-13-9-8-10-14-16;2*1-2/h8-10,12-14H,5-7,11,15H2,1-4H3;2*1-2H3/b18-12-,19-17-;; |
| InChIKey | CVHCVKZUHRGOQY-IOQMKEOLSA-N |
| XLogP | 7.73 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.57 |
| LogP ≤ 5 | 7.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|