C34H49N7O4 — CID 142986419
6-(1-butoxyethenyl)-8-cyclopentyl-5-methyl-2-[[5-(4-methylpiperazin-1-yl)-2-pyridinyl]amino]pyrido[2,3-d]pyrimidin-7-one;tert-butyl formate (PubChem CID 142986419) has the molecular formula C34H49N7O4 and a molecular weight of 619.81 g/mol. Its IUPAC name is 6-(1-butoxyethenyl)-8-cyclopentyl-5-methyl-2-[[5-(4-methylpiperazin-1-yl)-2-pyridinyl]amino]pyrido[2,3-d]pyrimidin-7-one;tert-butyl formate.
| Compound Name | 6-(1-butoxyethenyl)-8-cyclopentyl-5-methyl-2-[[5-(4-methylpiperazin-1-yl)-2-pyridinyl]amino]pyrido[2,3-d]pyrimidin-7-one;tert-butyl formate |
|---|---|
| PubChem CID | 142986419 |
| Molecular Formula | C34H49N7O4 |
| Molecular Weight | 619.81 g/mol |
| Exact Mass | 619.38 |
| IUPAC Name | 6-(1-butoxyethenyl)-8-cyclopentyl-5-methyl-2-[[5-(4-methylpiperazin-1-yl)-2-pyridinyl]amino]pyrido[2,3-d]pyrimidin-7-one;tert-butyl formate |
| SMILES | C=C(OCCCC)c1c(C)c2cnc(Nc3ccc(N4CCN(C)CC4)cn3)nc2n(C2CCCC2)c1=O.CC(C)(C)OC=O |
| InChI | InChI=1S/C29H39N7O2.C5H10O2/c1-5-6-17-38-21(3)26-20(2)24-19-31-29(33-27(24)36(28(26)37)22-9-7-8-10-22)32-25-12-11-23(18-30-25)35-15-13-34(4)14-16-35;1-5(2,3)7-4-6/h11-12,18-19,22H,3,5-10,13-17H2,1-2,4H3,(H,30,31,32,33);4H,1-3H3 |
| InChIKey | AWQMZASWDBFJQG-UHFFFAOYSA-N |
| XLogP | 5.85 |
| TPSA | 114.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 45 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 619.81 |
| LogP ≤ 5 | 5.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|