C36H54N6O3Si — CID 176885892
2-[[5-[4-[3-[tert-butyl(dimethyl)silyl]oxypropyl]piperidin-1-yl]-2-pyridinyl]amino]-8-cyclopentyl-6-(1-ethoxyethenyl)-5-methylpyrido[2,3-d]pyrimidin-7-one (PubChem CID 176885892) has the molecular formula C36H54N6O3Si and a molecular weight of 646.95 g/mol. Its IUPAC name is 2-[[5-[4-[3-[tert-butyl(dimethyl)silyl]oxypropyl]piperidin-1-yl]-2-pyridinyl]amino]-8-cyclopentyl-6-(1-ethoxyethenyl)-5-methylpyrido[2,3-d]pyrimidin-7-one.
| Compound Name | 2-[[5-[4-[3-[tert-butyl(dimethyl)silyl]oxypropyl]piperidin-1-yl]-2-pyridinyl]amino]-8-cyclopentyl-6-(1-ethoxyethenyl)-5-methylpyrido[2,3-d]pyrimidin-7-one |
|---|---|
| PubChem CID | 176885892 |
| Molecular Formula | C36H54N6O3Si |
| Molecular Weight | 646.95 g/mol |
| Exact Mass | 646.40 |
| IUPAC Name | 2-[[5-[4-[3-[tert-butyl(dimethyl)silyl]oxypropyl]piperidin-1-yl]-2-pyridinyl]amino]-8-cyclopentyl-6-(1-ethoxyethenyl)-5-methylpyrido[2,3-d]pyrimidin-7-one |
| SMILES | C=C(OCC)c1c(C)c2cnc(Nc3ccc(N4CCC(CCCO[Si](C)(C)C(C)(C)C)CC4)cn3)nc2n(C2CCCC2)c1=O |
| InChI | InChI=1S/C36H54N6O3Si/c1-9-44-26(3)32-25(2)30-24-38-35(40-33(30)42(34(32)43)28-14-10-11-15-28)39-31-17-16-29(23-37-31)41-20-18-27(19-21-41)13-12-22-45-46(7,8)36(4,5)6/h16-17,23-24,27-28H,3,9-15,18-22H2,1-2,4-8H3,(H,37,38,39,40) |
| InChIKey | FCMGUYPNXCUSIC-UHFFFAOYSA-N |
| XLogP | 8.38 |
| TPSA | 94.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 646.95 |
| LogP ≤ 5 | 8.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|