C17H27NO2 — CID 142986757
(3Z,4Z,6E)-3-ethylidene-1-[(2R)-2-(methoxymethyl)pyrrolidin-1-yl]-5-methylocta-4,6-dien-1-one (PubChem CID 142986757) has the molecular formula C17H27NO2 and a molecular weight of 277.41 g/mol. Its IUPAC name is (3Z,4Z,6E)-3-ethylidene-1-[(2R)-2-(methoxymethyl)pyrrolidin-1-yl]-5-methylocta-4,6-dien-1-one.
| Compound Name | (3Z,4Z,6E)-3-ethylidene-1-[(2R)-2-(methoxymethyl)pyrrolidin-1-yl]-5-methylocta-4,6-dien-1-one |
|---|---|
| PubChem CID | 142986757 |
| Molecular Formula | C17H27NO2 |
| Molecular Weight | 277.41 g/mol |
| Exact Mass | 277.20 |
| IUPAC Name | (3Z,4Z,6E)-3-ethylidene-1-[(2R)-2-(methoxymethyl)pyrrolidin-1-yl]-5-methylocta-4,6-dien-1-one |
| SMILES | C/C=C(\C=C(C)/C=C/C)CC(=O)N1CCC[C@@H]1COC |
| InChI | InChI=1S/C17H27NO2/c1-5-8-14(3)11-15(6-2)12-17(19)18-10-7-9-16(18)13-20-4/h5-6,8,11,16H,7,9-10,12-13H2,1-4H3/b8-5+,14-11-,15-6+/t16-/m1/s1 |
| InChIKey | XDQIMFXCXCLZIK-UPTHFMTBSA-N |
| XLogP | 3.48 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.41 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|