C28H38N4O4 — CID 142987993
tert-butyl N-[1-(2-hydroxyphenyl)-3-[1-oxo-2-(pyridin-3-ylmethyl)-2,8-diazaspiro[4.5]decan-8-yl]propyl]carbamate (PubChem CID 142987993) has the molecular formula C28H38N4O4 and a molecular weight of 494.64 g/mol. Its IUPAC name is tert-butyl N-[1-(2-hydroxyphenyl)-3-[1-oxo-2-(pyridin-3-ylmethyl)-2,8-diazaspiro[4.5]decan-8-yl]propyl]carbamate.
| Compound Name | tert-butyl N-[1-(2-hydroxyphenyl)-3-[1-oxo-2-(pyridin-3-ylmethyl)-2,8-diazaspiro[4.5]decan-8-yl]propyl]carbamate |
|---|---|
| PubChem CID | 142987993 |
| Molecular Formula | C28H38N4O4 |
| Molecular Weight | 494.64 g/mol |
| Exact Mass | 494.29 |
| IUPAC Name | tert-butyl N-[1-(2-hydroxyphenyl)-3-[1-oxo-2-(pyridin-3-ylmethyl)-2,8-diazaspiro[4.5]decan-8-yl]propyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NC(CCN1CCC2(CC1)CCN(Cc1cccnc1)C2=O)c1ccccc1O |
| InChI | InChI=1S/C28H38N4O4/c1-27(2,3)36-26(35)30-23(22-8-4-5-9-24(22)33)10-15-31-16-11-28(12-17-31)13-18-32(25(28)34)20-21-7-6-14-29-19-21/h4-9,14,19,23,33H,10-13,15-18,20H2,1-3H3,(H,30,35) |
| InChIKey | OBJLRQBVADKCOU-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 95.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.64 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|