C22H17F3N2O3S — CID 142988818
(E)-2-methyl-3-[4-[[5-methyl-4-[3-(trifluoromethyl)phenyl]-1,3-thiazol-2-yl]carbamoyl]phenyl]prop-2-enoic acid (PubChem CID 142988818) has the molecular formula C22H17F3N2O3S and a molecular weight of 446.45 g/mol. Its IUPAC name is (E)-2-methyl-3-[4-[[5-methyl-4-[3-(trifluoromethyl)phenyl]-1,3-thiazol-2-yl]carbamoyl]phenyl]prop-2-enoic acid.
| Compound Name | (E)-2-methyl-3-[4-[[5-methyl-4-[3-(trifluoromethyl)phenyl]-1,3-thiazol-2-yl]carbamoyl]phenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 142988818 |
| Molecular Formula | C22H17F3N2O3S |
| Molecular Weight | 446.45 g/mol |
| Exact Mass | 446.09 |
| IUPAC Name | (E)-2-methyl-3-[4-[[5-methyl-4-[3-(trifluoromethyl)phenyl]-1,3-thiazol-2-yl]carbamoyl]phenyl]prop-2-enoic acid |
| SMILES | C/C(=C\c1ccc(C(=O)Nc2nc(-c3cccc(C(F)(F)F)c3)c(C)s2)cc1)C(=O)O |
| InChI | InChI=1S/C22H17F3N2O3S/c1-12(20(29)30)10-14-6-8-15(9-7-14)19(28)27-21-26-18(13(2)31-21)16-4-3-5-17(11-16)22(23,24)25/h3-11H,1-2H3,(H,29,30)(H,26,27,28)/b12-10+ |
| InChIKey | NFXRGGFMCOUSBM-ZRDIBKRKSA-N |
| XLogP | 5.88 |
| TPSA | 79.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.45 |
| LogP ≤ 5 | 5.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|