C17H11BrCl2N2OS — CID 2276030
4-bromo-N-[4-(3,4-dichlorophenyl)-5-methyl-1,3-thiazol-2-yl]benzamide (PubChem CID 2276030) has the molecular formula C17H11BrCl2N2OS and a molecular weight of 442.17 g/mol. Its IUPAC name is 4-bromo-N-[4-(3,4-dichlorophenyl)-5-methyl-1,3-thiazol-2-yl]benzamide.
| Compound Name | 4-bromo-N-[4-(3,4-dichlorophenyl)-5-methyl-1,3-thiazol-2-yl]benzamide |
|---|---|
| PubChem CID | 2276030 |
| Molecular Formula | C17H11BrCl2N2OS |
| Molecular Weight | 442.17 g/mol |
| Exact Mass | 439.92 |
| IUPAC Name | 4-bromo-N-[4-(3,4-dichlorophenyl)-5-methyl-1,3-thiazol-2-yl]benzamide |
| SMILES | Cc1sc(NC(=O)c2ccc(Br)cc2)nc1-c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C17H11BrCl2N2OS/c1-9-15(11-4-7-13(19)14(20)8-11)21-17(24-9)22-16(23)10-2-5-12(18)6-3-10/h2-8H,1H3,(H,21,22,23) |
| InChIKey | IZQOCKCBJAZRAO-UHFFFAOYSA-N |
| XLogP | 6.44 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.17 |
| LogP ≤ 5 | 6.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |