C18H12BrN3OS — CID 9094383
N-[4-(4-bromophenyl)-5-methyl-1,3-thiazol-2-yl]-3-cyanobenzamide (PubChem CID 9094383) has the molecular formula C18H12BrN3OS and a molecular weight of 398.29 g/mol. Its IUPAC name is N-[4-(4-bromophenyl)-5-methyl-1,3-thiazol-2-yl]-3-cyanobenzamide.
| Compound Name | N-[4-(4-bromophenyl)-5-methyl-1,3-thiazol-2-yl]-3-cyanobenzamide |
|---|---|
| PubChem CID | 9094383 |
| Molecular Formula | C18H12BrN3OS |
| Molecular Weight | 398.29 g/mol |
| Exact Mass | 396.99 |
| IUPAC Name | N-[4-(4-bromophenyl)-5-methyl-1,3-thiazol-2-yl]-3-cyanobenzamide |
| SMILES | Cc1sc(NC(=O)c2cccc(C#N)c2)nc1-c1ccc(Br)cc1 |
| InChI | InChI=1S/C18H12BrN3OS/c1-11-16(13-5-7-15(19)8-6-13)21-18(24-11)22-17(23)14-4-2-3-12(9-14)10-20/h2-9H,1H3,(H,21,22,23) |
| InChIKey | YOKAVIUFDIYXKN-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 65.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.29 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |