C23H25BrN2O4S — CID 19211561
N-[4-(4-bromophenyl)-5-methyl-1,3-thiazol-2-yl]-3,4,5-triethoxybenzamide (PubChem CID 19211561) has the molecular formula C23H25BrN2O4S and a molecular weight of 505.43 g/mol. Its IUPAC name is N-[4-(4-bromophenyl)-5-methyl-1,3-thiazol-2-yl]-3,4,5-triethoxybenzamide.
| Compound Name | N-[4-(4-bromophenyl)-5-methyl-1,3-thiazol-2-yl]-3,4,5-triethoxybenzamide |
|---|---|
| PubChem CID | 19211561 |
| Molecular Formula | C23H25BrN2O4S |
| Molecular Weight | 505.43 g/mol |
| Exact Mass | 504.07 |
| IUPAC Name | N-[4-(4-bromophenyl)-5-methyl-1,3-thiazol-2-yl]-3,4,5-triethoxybenzamide |
| SMILES | CCOc1cc(C(=O)Nc2nc(-c3ccc(Br)cc3)c(C)s2)cc(OCC)c1OCC |
| InChI | InChI=1S/C23H25BrN2O4S/c1-5-28-18-12-16(13-19(29-6-2)21(18)30-7-3)22(27)26-23-25-20(14(4)31-23)15-8-10-17(24)11-9-15/h8-13H,5-7H2,1-4H3,(H,25,26,27) |
| InChIKey | DAITXKSWUKSTCN-UHFFFAOYSA-N |
| XLogP | 6.33 |
| TPSA | 69.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.43 |
| LogP ≤ 5 | 6.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |