C15H11BrN2O2S — CID 18102185
N-[4-(4-bromophenyl)-5-methyl-1,3-thiazol-2-yl]furan-3-carboxamide (PubChem CID 18102185) has the molecular formula C15H11BrN2O2S and a molecular weight of 363.24 g/mol. Its IUPAC name is N-[4-(4-bromophenyl)-5-methyl-1,3-thiazol-2-yl]furan-3-carboxamide.
| Compound Name | N-[4-(4-bromophenyl)-5-methyl-1,3-thiazol-2-yl]furan-3-carboxamide |
|---|---|
| PubChem CID | 18102185 |
| Molecular Formula | C15H11BrN2O2S |
| Molecular Weight | 363.24 g/mol |
| Exact Mass | 361.97 |
| IUPAC Name | N-[4-(4-bromophenyl)-5-methyl-1,3-thiazol-2-yl]furan-3-carboxamide |
| SMILES | Cc1sc(NC(=O)c2ccoc2)nc1-c1ccc(Br)cc1 |
| InChI | InChI=1S/C15H11BrN2O2S/c1-9-13(10-2-4-12(16)5-3-10)17-15(21-9)18-14(19)11-6-7-20-8-11/h2-8H,1H3,(H,17,18,19) |
| InChIKey | NYXOOZVCCLSDNF-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 55.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.24 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |