C20H23N5O4S — CID 142990097
ethyl 4-[5-cyano-6-(4-methylsulfinylanilino)pyrimidin-4-yl]oxypiperidine-1-carboxylate (PubChem CID 142990097) has the molecular formula C20H23N5O4S and a molecular weight of 429.50 g/mol. Its IUPAC name is ethyl 4-[5-cyano-6-(4-methylsulfinylanilino)pyrimidin-4-yl]oxypiperidine-1-carboxylate.
| Compound Name | ethyl 4-[5-cyano-6-(4-methylsulfinylanilino)pyrimidin-4-yl]oxypiperidine-1-carboxylate |
|---|---|
| PubChem CID | 142990097 |
| Molecular Formula | C20H23N5O4S |
| Molecular Weight | 429.50 g/mol |
| Exact Mass | 429.15 |
| IUPAC Name | ethyl 4-[5-cyano-6-(4-methylsulfinylanilino)pyrimidin-4-yl]oxypiperidine-1-carboxylate |
| SMILES | CCOC(=O)N1CCC(Oc2ncnc(Nc3ccc(S(C)=O)cc3)c2C#N)CC1 |
| InChI | InChI=1S/C20H23N5O4S/c1-3-28-20(26)25-10-8-15(9-11-25)29-19-17(12-21)18(22-13-23-19)24-14-4-6-16(7-5-14)30(2)27/h4-7,13,15H,3,8-11H2,1-2H3,(H,22,23,24) |
| InChIKey | AMNDHHOVNHIBDN-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 117.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.50 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |