About piperidine-4-carbonyl fluoride
piperidine-4-carbonyl fluoride (PubChem CID 142990461) has the molecular formula C6H10FNO
and a molecular weight of 131.15 g/mol. Its IUPAC name is piperidine-4-carbonyl fluoride.
Molecular Properties
| Compound Name | piperidine-4-carbonyl fluoride |
| PubChem CID | 142990461 |
| Molecular Formula | C6H10FNO |
| Molecular Weight | 131.15 g/mol |
| Exact Mass | 131.07 |
| IUPAC Name | piperidine-4-carbonyl fluoride |
| SMILES | O=C(F)C1CCNCC1 |
| InChI | InChI=1S/C6H10FNO/c7-6(9)5-1-3-8-4-2-5/h5,8H,1-4H2 |
| InChIKey | CIFWFWFVKSPDHP-UHFFFAOYSA-N |
| XLogP | 0.48 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 131.15 |
| LogP ≤ 5 | 0.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'} |
|---|
Analyze piperidine-4-carbonyl fluoride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of piperidine-4-carbonyl fluoride?
The IUPAC name of piperidine-4-carbonyl fluoride (CID 142990461) is piperidine-4-carbonyl fluoride.
What is the SMILES notation for piperidine-4-carbonyl fluoride?
The canonical SMILES for piperidine-4-carbonyl fluoride is O=C(F)C1CCNCC1.
What is the InChIKey of piperidine-4-carbonyl fluoride?
The InChIKey is CIFWFWFVKSPDHP-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H10FNO/c7-6(9)5-1-3-8-4-2-5/h5,8H,1-4H2.
What are the key properties of piperidine-4-carbonyl fluoride?
piperidine-4-carbonyl fluoride has a molecular weight of 131.15 g/mol, XLogP of 0.48, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for piperidine-4-carbonyl fluoride is sourced from PubChem (CID 142990461), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).