C16H18N4O5 — CID 142992517
2-[2-methoxy-4-(2-methoxyethylcarbamoyl)phenoxy]pyrimidine-5-carboxamide (PubChem CID 142992517) has the molecular formula C16H18N4O5 and a molecular weight of 346.34 g/mol. Its IUPAC name is 2-[2-methoxy-4-(2-methoxyethylcarbamoyl)phenoxy]pyrimidine-5-carboxamide.
| Compound Name | 2-[2-methoxy-4-(2-methoxyethylcarbamoyl)phenoxy]pyrimidine-5-carboxamide |
|---|---|
| PubChem CID | 142992517 |
| Molecular Formula | C16H18N4O5 |
| Molecular Weight | 346.34 g/mol |
| Exact Mass | 346.13 |
| IUPAC Name | 2-[2-methoxy-4-(2-methoxyethylcarbamoyl)phenoxy]pyrimidine-5-carboxamide |
| SMILES | COCCNC(=O)c1ccc(Oc2ncc(C(N)=O)cn2)c(OC)c1 |
| InChI | InChI=1S/C16H18N4O5/c1-23-6-5-18-15(22)10-3-4-12(13(7-10)24-2)25-16-19-8-11(9-20-16)14(17)21/h3-4,7-9H,5-6H2,1-2H3,(H2,17,21)(H,18,22) |
| InChIKey | QATNCSCHADYNIG-UHFFFAOYSA-N |
| XLogP | 0.75 |
| TPSA | 125.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.34 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|