C7H16N2O — CID 142994239
2-[(2R,5S)-5-(aminomethyl)oxolan-2-yl]ethanamine (PubChem CID 142994239) has the molecular formula C7H16N2O and a molecular weight of 144.22 g/mol. Its IUPAC name is 2-[(2R,5S)-5-(aminomethyl)oxolan-2-yl]ethanamine.
| Compound Name | 2-[(2R,5S)-5-(aminomethyl)oxolan-2-yl]ethanamine |
|---|---|
| PubChem CID | 142994239 |
| Molecular Formula | C7H16N2O |
| Molecular Weight | 144.22 g/mol |
| Exact Mass | 144.13 |
| IUPAC Name | 2-[(2R,5S)-5-(aminomethyl)oxolan-2-yl]ethanamine |
| SMILES | NCC[C@H]1CC[C@@H](CN)O1 |
| InChI | InChI=1S/C7H16N2O/c8-4-3-6-1-2-7(5-9)10-6/h6-7H,1-5,8-9H2/t6-,7+/m1/s1 |
| InChIKey | QTWISUWRVURBJY-RQJHMYQMSA-N |
| XLogP | -0.16 |
| TPSA | 61.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 144.22 |
| LogP ≤ 5 | -0.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |