C13H12O3 — CID 142994874
6-acetyl-2-methyl-2,3-dihydronaphthalene-1,4-dione (PubChem CID 142994874) has the molecular formula C13H12O3 and a molecular weight of 216.24 g/mol. Its IUPAC name is 6-acetyl-2-methyl-2,3-dihydronaphthalene-1,4-dione.
| Compound Name | 6-acetyl-2-methyl-2,3-dihydronaphthalene-1,4-dione |
|---|---|
| PubChem CID | 142994874 |
| Molecular Formula | C13H12O3 |
| Molecular Weight | 216.24 g/mol |
| Exact Mass | 216.08 |
| IUPAC Name | 6-acetyl-2-methyl-2,3-dihydronaphthalene-1,4-dione |
| SMILES | CC(=O)c1ccc2c(c1)C(=O)CC(C)C2=O |
| InChI | InChI=1S/C13H12O3/c1-7-5-12(15)11-6-9(8(2)14)3-4-10(11)13(7)16/h3-4,6-7H,5H2,1-2H3 |
| InChIKey | OYVCAEAAHMKJBB-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 51.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.24 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'keto_keto_gamma(5)', 'substructure': 'N/A'} |
|---|