C11H8FN3O3 — CID 142995031
2-fluoro-N-(5-formyl-1H-pyrazol-4-yl)-6-hydroxybenzamide (PubChem CID 142995031) has the molecular formula C11H8FN3O3 and a molecular weight of 249.20 g/mol. Its IUPAC name is 2-fluoro-N-(5-formyl-1H-pyrazol-4-yl)-6-hydroxybenzamide.
| Compound Name | 2-fluoro-N-(5-formyl-1H-pyrazol-4-yl)-6-hydroxybenzamide |
|---|---|
| PubChem CID | 142995031 |
| Molecular Formula | C11H8FN3O3 |
| Molecular Weight | 249.20 g/mol |
| Exact Mass | 249.05 |
| IUPAC Name | 2-fluoro-N-(5-formyl-1H-pyrazol-4-yl)-6-hydroxybenzamide |
| SMILES | O=Cc1[nH]ncc1NC(=O)c1c(O)cccc1F |
| InChI | InChI=1S/C11H8FN3O3/c12-6-2-1-3-9(17)10(6)11(18)14-7-4-13-15-8(7)5-16/h1-5,17H,(H,13,15)(H,14,18) |
| InChIKey | WVLIJRIUSIMPCE-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 95.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.20 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|