C17H25Cl2N5O2 — CID 142995094
2,6-dichloro-N-(5-formyl-1H-pyrazol-4-yl)benzamide;ethanamine;N-methylpropan-1-amine (PubChem CID 142995094) has the molecular formula C17H25Cl2N5O2 and a molecular weight of 402.33 g/mol. Its IUPAC name is 2,6-dichloro-N-(5-formyl-1H-pyrazol-4-yl)benzamide;ethanamine;N-methylpropan-1-amine.
| Compound Name | 2,6-dichloro-N-(5-formyl-1H-pyrazol-4-yl)benzamide;ethanamine;N-methylpropan-1-amine |
|---|---|
| PubChem CID | 142995094 |
| Molecular Formula | C17H25Cl2N5O2 |
| Molecular Weight | 402.33 g/mol |
| Exact Mass | 401.14 |
| IUPAC Name | 2,6-dichloro-N-(5-formyl-1H-pyrazol-4-yl)benzamide;ethanamine;N-methylpropan-1-amine |
| SMILES | CCCNC.CCN.O=Cc1[nH]ncc1NC(=O)c1c(Cl)cccc1Cl |
| InChI | InChI=1S/C11H7Cl2N3O2.C4H11N.C2H7N/c12-6-2-1-3-7(13)10(6)11(18)15-8-4-14-16-9(8)5-17;1-3-4-5-2;1-2-3/h1-5H,(H,14,16)(H,15,18);5H,3-4H2,1-2H3;2-3H2,1H3 |
| InChIKey | PBZOPDLBBRUZOD-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 112.90 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.33 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|