C17H26N5O2P — CID 142995079
N-(5-formyl-1H-pyrazol-4-yl)-4-phosphanylbenzamide;1-N-methylpentane-1,3-diamine (PubChem CID 142995079) has the molecular formula C17H26N5O2P and a molecular weight of 363.40 g/mol. Its IUPAC name is N-(5-formyl-1H-pyrazol-4-yl)-4-phosphanylbenzamide;1-N-methylpentane-1,3-diamine.
| Compound Name | N-(5-formyl-1H-pyrazol-4-yl)-4-phosphanylbenzamide;1-N-methylpentane-1,3-diamine |
|---|---|
| PubChem CID | 142995079 |
| Molecular Formula | C17H26N5O2P |
| Molecular Weight | 363.40 g/mol |
| Exact Mass | 363.18 |
| IUPAC Name | N-(5-formyl-1H-pyrazol-4-yl)-4-phosphanylbenzamide;1-N-methylpentane-1,3-diamine |
| SMILES | CCC(N)CCNC.O=Cc1[nH]ncc1NC(=O)c1ccc(P)cc1 |
| InChI | InChI=1S/C11H10N3O2P.C6H16N2/c15-6-10-9(5-12-14-10)13-11(16)7-1-3-8(17)4-2-7;1-3-6(7)4-5-8-2/h1-6H,17H2,(H,12,14)(H,13,16);6,8H,3-5,7H2,1-2H3 |
| InChIKey | KBKORRCHAMDHSH-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 112.90 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.40 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|