C18H24ClN5O2 — CID 143263527
4-[(4-chlorobenzoyl)amino]-N-[6-(methylamino)hexan-3-yl]-1H-pyrazole-5-carboxamide (PubChem CID 143263527) has the molecular formula C18H24ClN5O2 and a molecular weight of 377.88 g/mol. Its IUPAC name is 4-[(4-chlorobenzoyl)amino]-N-[6-(methylamino)hexan-3-yl]-1H-pyrazole-5-carboxamide.
| Compound Name | 4-[(4-chlorobenzoyl)amino]-N-[6-(methylamino)hexan-3-yl]-1H-pyrazole-5-carboxamide |
|---|---|
| PubChem CID | 143263527 |
| Molecular Formula | C18H24ClN5O2 |
| Molecular Weight | 377.88 g/mol |
| Exact Mass | 377.16 |
| IUPAC Name | 4-[(4-chlorobenzoyl)amino]-N-[6-(methylamino)hexan-3-yl]-1H-pyrazole-5-carboxamide |
| SMILES | CCC(CCCNC)NC(=O)c1[nH]ncc1NC(=O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C18H24ClN5O2/c1-3-14(5-4-10-20-2)22-18(26)16-15(11-21-24-16)23-17(25)12-6-8-13(19)9-7-12/h6-9,11,14,20H,3-5,10H2,1-2H3,(H,21,24)(H,22,26)(H,23,25) |
| InChIKey | UVTUZHWHRDHDPY-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 98.91 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.88 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|