C15H15N5O2 — CID 68991326
N-(2-cyanoethyl)-4-[(4-methylbenzoyl)amino]-1H-pyrazole-5-carboxamide (PubChem CID 68991326) has the molecular formula C15H15N5O2 and a molecular weight of 297.32 g/mol. Its IUPAC name is N-(2-cyanoethyl)-4-[(4-methylbenzoyl)amino]-1H-pyrazole-5-carboxamide.
| Compound Name | N-(2-cyanoethyl)-4-[(4-methylbenzoyl)amino]-1H-pyrazole-5-carboxamide |
|---|---|
| PubChem CID | 68991326 |
| Molecular Formula | C15H15N5O2 |
| Molecular Weight | 297.32 g/mol |
| Exact Mass | 297.12 |
| IUPAC Name | N-(2-cyanoethyl)-4-[(4-methylbenzoyl)amino]-1H-pyrazole-5-carboxamide |
| SMILES | Cc1ccc(C(=O)Nc2cn[nH]c2C(=O)NCCC#N)cc1 |
| InChI | InChI=1S/C15H15N5O2/c1-10-3-5-11(6-4-10)14(21)19-12-9-18-20-13(12)15(22)17-8-2-7-16/h3-6,9H,2,8H2,1H3,(H,17,22)(H,18,20)(H,19,21) |
| InChIKey | KCWAKGNABQBVSY-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 110.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.32 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|