C15H12N6O2 — CID 68990628
4-[(3-cyanobenzoyl)amino]-N-(2-cyanoethyl)-1H-pyrazole-5-carboxamide (PubChem CID 68990628) has the molecular formula C15H12N6O2 and a molecular weight of 308.30 g/mol. Its IUPAC name is 4-[(3-cyanobenzoyl)amino]-N-(2-cyanoethyl)-1H-pyrazole-5-carboxamide.
| Compound Name | 4-[(3-cyanobenzoyl)amino]-N-(2-cyanoethyl)-1H-pyrazole-5-carboxamide |
|---|---|
| PubChem CID | 68990628 |
| Molecular Formula | C15H12N6O2 |
| Molecular Weight | 308.30 g/mol |
| Exact Mass | 308.10 |
| IUPAC Name | 4-[(3-cyanobenzoyl)amino]-N-(2-cyanoethyl)-1H-pyrazole-5-carboxamide |
| SMILES | N#CCCNC(=O)c1[nH]ncc1NC(=O)c1cccc(C#N)c1 |
| InChI | InChI=1S/C15H12N6O2/c16-5-2-6-18-15(23)13-12(9-19-21-13)20-14(22)11-4-1-3-10(7-11)8-17/h1,3-4,7,9H,2,6H2,(H,18,23)(H,19,21)(H,20,22) |
| InChIKey | YOVJDEFLAZTBBE-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 134.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.30 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|