C13H13N3O3 — CID 174510787
[4-[(4-methylbenzoyl)amino]-1H-pyrazol-5-yl]methyl formate (PubChem CID 174510787) has the molecular formula C13H13N3O3 and a molecular weight of 259.26 g/mol. Its IUPAC name is [4-[(4-methylbenzoyl)amino]-1H-pyrazol-5-yl]methyl formate.
| Compound Name | [4-[(4-methylbenzoyl)amino]-1H-pyrazol-5-yl]methyl formate |
|---|---|
| PubChem CID | 174510787 |
| Molecular Formula | C13H13N3O3 |
| Molecular Weight | 259.26 g/mol |
| Exact Mass | 259.10 |
| IUPAC Name | [4-[(4-methylbenzoyl)amino]-1H-pyrazol-5-yl]methyl formate |
| SMILES | Cc1ccc(C(=O)Nc2cn[nH]c2COC=O)cc1 |
| InChI | InChI=1S/C13H13N3O3/c1-9-2-4-10(5-3-9)13(18)15-11-6-14-16-12(11)7-19-8-17/h2-6,8H,7H2,1H3,(H,14,16)(H,15,18) |
| InChIKey | KDIHPEUBUISTAI-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 84.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.26 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|