About prop-1-en-2-yl N-(5-formyl-1H-pyrazol-4-yl)carbamate
prop-1-en-2-yl N-(5-formyl-1H-pyrazol-4-yl)carbamate (PubChem CID 88849088) has the molecular formula C8H9N3O3
and a molecular weight of 195.18 g/mol. Its IUPAC name is prop-1-en-2-yl N-(5-formyl-1H-pyrazol-4-yl)carbamate.
Molecular Properties
| Compound Name | prop-1-en-2-yl N-(5-formyl-1H-pyrazol-4-yl)carbamate |
| PubChem CID | 88849088 |
| Molecular Formula | C8H9N3O3 |
| Molecular Weight | 195.18 g/mol |
| Exact Mass | 195.06 |
| IUPAC Name | prop-1-en-2-yl N-(5-formyl-1H-pyrazol-4-yl)carbamate |
| SMILES | C=C(C)OC(=O)Nc1cn[nH]c1C=O |
| InChI | InChI=1S/C8H9N3O3/c1-5(2)14-8(13)10-6-3-9-11-7(6)4-12/h3-4H,1H2,2H3,(H,9,11)(H,10,13) |
| InChIKey | BIGXTNKHILZLIK-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 84.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 195.18 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze prop-1-en-2-yl N-(5-formyl-1H-pyrazol-4-yl)carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of prop-1-en-2-yl N-(5-formyl-1H-pyrazol-4-yl)carbamate?
The IUPAC name of prop-1-en-2-yl N-(5-formyl-1H-pyrazol-4-yl)carbamate (CID 88849088) is prop-1-en-2-yl N-(5-formyl-1H-pyrazol-4-yl)carbamate.
What is the SMILES notation for prop-1-en-2-yl N-(5-formyl-1H-pyrazol-4-yl)carbamate?
The canonical SMILES for prop-1-en-2-yl N-(5-formyl-1H-pyrazol-4-yl)carbamate is C=C(C)OC(=O)Nc1cn[nH]c1C=O.
What is the InChIKey of prop-1-en-2-yl N-(5-formyl-1H-pyrazol-4-yl)carbamate?
The InChIKey is BIGXTNKHILZLIK-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H9N3O3/c1-5(2)14-8(13)10-6-3-9-11-7(6)4-12/h3-4H,1H2,2H3,(H,9,11)(H,10,13).
What are the key properties of prop-1-en-2-yl N-(5-formyl-1H-pyrazol-4-yl)carbamate?
prop-1-en-2-yl N-(5-formyl-1H-pyrazol-4-yl)carbamate has a molecular weight of 195.18 g/mol, XLogP of 1.30, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for prop-1-en-2-yl N-(5-formyl-1H-pyrazol-4-yl)carbamate is sourced from PubChem (CID 88849088), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).