C18H25N5O4S — CID 69381656
4-[[4-(dipropylsulfamoyl)benzoyl]amino]-N-methyl-1H-pyrazole-5-carboxamide (PubChem CID 69381656) has the molecular formula C18H25N5O4S and a molecular weight of 407.50 g/mol. Its IUPAC name is 4-[[4-(dipropylsulfamoyl)benzoyl]amino]-N-methyl-1H-pyrazole-5-carboxamide.
| Compound Name | 4-[[4-(dipropylsulfamoyl)benzoyl]amino]-N-methyl-1H-pyrazole-5-carboxamide |
|---|---|
| PubChem CID | 69381656 |
| Molecular Formula | C18H25N5O4S |
| Molecular Weight | 407.50 g/mol |
| Exact Mass | 407.16 |
| IUPAC Name | 4-[[4-(dipropylsulfamoyl)benzoyl]amino]-N-methyl-1H-pyrazole-5-carboxamide |
| SMILES | CCCN(CCC)S(=O)(=O)c1ccc(C(=O)Nc2cn[nH]c2C(=O)NC)cc1 |
| InChI | InChI=1S/C18H25N5O4S/c1-4-10-23(11-5-2)28(26,27)14-8-6-13(7-9-14)17(24)21-15-12-20-22-16(15)18(25)19-3/h6-9,12H,4-5,10-11H2,1-3H3,(H,19,25)(H,20,22)(H,21,24) |
| InChIKey | WIKNMMWROHMVKH-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 124.26 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.50 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |