C22H24Cl2N4O — CID 139782357
2,6-dichloro-N-[3-methyl-4-[2-(propylamino)ethylamino]quinolin-8-yl]benzamide (PubChem CID 139782357) has the molecular formula C22H24Cl2N4O and a molecular weight of 431.37 g/mol. Its IUPAC name is 2,6-dichloro-N-[3-methyl-4-[2-(propylamino)ethylamino]quinolin-8-yl]benzamide.
| Compound Name | 2,6-dichloro-N-[3-methyl-4-[2-(propylamino)ethylamino]quinolin-8-yl]benzamide |
|---|---|
| PubChem CID | 139782357 |
| Molecular Formula | C22H24Cl2N4O |
| Molecular Weight | 431.37 g/mol |
| Exact Mass | 430.13 |
| IUPAC Name | 2,6-dichloro-N-[3-methyl-4-[2-(propylamino)ethylamino]quinolin-8-yl]benzamide |
| SMILES | CCCNCCNc1c(C)cnc2c(NC(=O)c3c(Cl)cccc3Cl)cccc12 |
| InChI | InChI=1S/C22H24Cl2N4O/c1-3-10-25-11-12-26-20-14(2)13-27-21-15(20)6-4-9-18(21)28-22(29)19-16(23)7-5-8-17(19)24/h4-9,13,25H,3,10-12H2,1-2H3,(H,26,27)(H,28,29) |
| InChIKey | QUAWTTVJQZCDNC-UHFFFAOYSA-N |
| XLogP | 5.51 |
| TPSA | 66.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.37 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|