C16H8Cl4N2O — CID 139782538
2,6-dichloro-N-(3,4-dichloroquinolin-8-yl)benzamide (PubChem CID 139782538) has the molecular formula C16H8Cl4N2O and a molecular weight of 386.07 g/mol. Its IUPAC name is 2,6-dichloro-N-(3,4-dichloroquinolin-8-yl)benzamide.
| Compound Name | 2,6-dichloro-N-(3,4-dichloroquinolin-8-yl)benzamide |
|---|---|
| PubChem CID | 139782538 |
| Molecular Formula | C16H8Cl4N2O |
| Molecular Weight | 386.07 g/mol |
| Exact Mass | 383.94 |
| IUPAC Name | 2,6-dichloro-N-(3,4-dichloroquinolin-8-yl)benzamide |
| SMILES | O=C(Nc1cccc2c(Cl)c(Cl)cnc12)c1c(Cl)cccc1Cl |
| InChI | InChI=1S/C16H8Cl4N2O/c17-9-4-2-5-10(18)13(9)16(23)22-12-6-1-3-8-14(20)11(19)7-21-15(8)12/h1-7H,(H,22,23) |
| InChIKey | UPIAUFMJXWOLQZ-UHFFFAOYSA-N |
| XLogP | 6.10 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.07 |
| LogP ≤ 5 | 6.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |