C23H14Cl4N2O2 — CID 139782456
2,6-dichloro-N-[4-(3,4-dichlorophenoxy)-3-methylquinolin-8-yl]benzamide (PubChem CID 139782456) has the molecular formula C23H14Cl4N2O2 and a molecular weight of 492.19 g/mol. Its IUPAC name is 2,6-dichloro-N-[4-(3,4-dichlorophenoxy)-3-methylquinolin-8-yl]benzamide.
| Compound Name | 2,6-dichloro-N-[4-(3,4-dichlorophenoxy)-3-methylquinolin-8-yl]benzamide |
|---|---|
| PubChem CID | 139782456 |
| Molecular Formula | C23H14Cl4N2O2 |
| Molecular Weight | 492.19 g/mol |
| Exact Mass | 489.98 |
| IUPAC Name | 2,6-dichloro-N-[4-(3,4-dichlorophenoxy)-3-methylquinolin-8-yl]benzamide |
| SMILES | Cc1cnc2c(NC(=O)c3c(Cl)cccc3Cl)cccc2c1Oc1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C23H14Cl4N2O2/c1-12-11-28-21-14(22(12)31-13-8-9-15(24)18(27)10-13)4-2-7-19(21)29-23(30)20-16(25)5-3-6-17(20)26/h2-11H,1H3,(H,29,30) |
| InChIKey | CVCRNHSUWVSNPM-UHFFFAOYSA-N |
| XLogP | 8.20 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.19 |
| LogP ≤ 5 | 8.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |