C17H10Br2Cl2N2O — CID 19592628
N-[3-bromo-4-(bromomethyl)quinolin-8-yl]-2,6-dichlorobenzamide (PubChem CID 19592628) has the molecular formula C17H10Br2Cl2N2O and a molecular weight of 488.99 g/mol. Its IUPAC name is N-[3-bromo-4-(bromomethyl)quinolin-8-yl]-2,6-dichlorobenzamide.
| Compound Name | N-[3-bromo-4-(bromomethyl)quinolin-8-yl]-2,6-dichlorobenzamide |
|---|---|
| PubChem CID | 19592628 |
| Molecular Formula | C17H10Br2Cl2N2O |
| Molecular Weight | 488.99 g/mol |
| Exact Mass | 485.85 |
| IUPAC Name | N-[3-bromo-4-(bromomethyl)quinolin-8-yl]-2,6-dichlorobenzamide |
| SMILES | O=C(Nc1cccc2c(CBr)c(Br)cnc12)c1c(Cl)cccc1Cl |
| InChI | InChI=1S/C17H10Br2Cl2N2O/c18-7-10-9-3-1-6-14(16(9)22-8-11(10)19)23-17(24)15-12(20)4-2-5-13(15)21/h1-6,8H,7H2,(H,23,24) |
| InChIKey | AJVIMOYELFKLDQ-UHFFFAOYSA-N |
| XLogP | 6.45 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.99 |
| LogP ≤ 5 | 6.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|