C19H16Cl2N4O2 — CID 19592886
N-[4-(2-acetyl-2-methylhydrazinyl)quinolin-8-yl]-2,6-dichlorobenzamide (PubChem CID 19592886) has the molecular formula C19H16Cl2N4O2 and a molecular weight of 403.27 g/mol. Its IUPAC name is N-[4-(2-acetyl-2-methylhydrazinyl)quinolin-8-yl]-2,6-dichlorobenzamide.
| Compound Name | N-[4-(2-acetyl-2-methylhydrazinyl)quinolin-8-yl]-2,6-dichlorobenzamide |
|---|---|
| PubChem CID | 19592886 |
| Molecular Formula | C19H16Cl2N4O2 |
| Molecular Weight | 403.27 g/mol |
| Exact Mass | 402.07 |
| IUPAC Name | N-[4-(2-acetyl-2-methylhydrazinyl)quinolin-8-yl]-2,6-dichlorobenzamide |
| SMILES | CC(=O)N(C)Nc1ccnc2c(NC(=O)c3c(Cl)cccc3Cl)cccc12 |
| InChI | InChI=1S/C19H16Cl2N4O2/c1-11(26)25(2)24-15-9-10-22-18-12(15)5-3-8-16(18)23-19(27)17-13(20)6-4-7-14(17)21/h3-10H,1-2H3,(H,22,24)(H,23,27) |
| InChIKey | PQFUKFARKPYJMI-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 74.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.27 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|