C17H11Cl3N2O — CID 19592406
2,6-dichloro-N-(4-chloro-5-methylquinolin-8-yl)benzamide (PubChem CID 19592406) has the molecular formula C17H11Cl3N2O and a molecular weight of 365.65 g/mol. Its IUPAC name is 2,6-dichloro-N-(4-chloro-5-methylquinolin-8-yl)benzamide.
| Compound Name | 2,6-dichloro-N-(4-chloro-5-methylquinolin-8-yl)benzamide |
|---|---|
| PubChem CID | 19592406 |
| Molecular Formula | C17H11Cl3N2O |
| Molecular Weight | 365.65 g/mol |
| Exact Mass | 363.99 |
| IUPAC Name | 2,6-dichloro-N-(4-chloro-5-methylquinolin-8-yl)benzamide |
| SMILES | Cc1ccc(NC(=O)c2c(Cl)cccc2Cl)c2nccc(Cl)c12 |
| InChI | InChI=1S/C17H11Cl3N2O/c1-9-5-6-13(16-14(9)12(20)7-8-21-16)22-17(23)15-10(18)3-2-4-11(15)19/h2-8H,1H3,(H,22,23) |
| InChIKey | DOHIAIQAJUTOAS-UHFFFAOYSA-N |
| XLogP | 5.76 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.65 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |