C20H19Cl2N3O2 — CID 19592575
2,6-dichloro-N-[4-[2-methoxyethyl(methyl)amino]quinolin-8-yl]benzamide (PubChem CID 19592575) has the molecular formula C20H19Cl2N3O2 and a molecular weight of 404.30 g/mol. Its IUPAC name is 2,6-dichloro-N-[4-[2-methoxyethyl(methyl)amino]quinolin-8-yl]benzamide.
| Compound Name | 2,6-dichloro-N-[4-[2-methoxyethyl(methyl)amino]quinolin-8-yl]benzamide |
|---|---|
| PubChem CID | 19592575 |
| Molecular Formula | C20H19Cl2N3O2 |
| Molecular Weight | 404.30 g/mol |
| Exact Mass | 403.09 |
| IUPAC Name | 2,6-dichloro-N-[4-[2-methoxyethyl(methyl)amino]quinolin-8-yl]benzamide |
| SMILES | COCCN(C)c1ccnc2c(NC(=O)c3c(Cl)cccc3Cl)cccc12 |
| InChI | InChI=1S/C20H19Cl2N3O2/c1-25(11-12-27-2)17-9-10-23-19-13(17)5-3-8-16(19)24-20(26)18-14(21)6-4-7-15(18)22/h3-10H,11-12H2,1-2H3,(H,24,26) |
| InChIKey | XUEYIGUKGWDIRV-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 54.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.30 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |