C21H16Cl2N4O2 — CID 19592781
2,6-dichloro-N-[3-(methoxymethyl)-4-pyrazol-1-ylquinolin-8-yl]benzamide (PubChem CID 19592781) has the molecular formula C21H16Cl2N4O2 and a molecular weight of 427.29 g/mol. Its IUPAC name is 2,6-dichloro-N-[3-(methoxymethyl)-4-pyrazol-1-ylquinolin-8-yl]benzamide.
| Compound Name | 2,6-dichloro-N-[3-(methoxymethyl)-4-pyrazol-1-ylquinolin-8-yl]benzamide |
|---|---|
| PubChem CID | 19592781 |
| Molecular Formula | C21H16Cl2N4O2 |
| Molecular Weight | 427.29 g/mol |
| Exact Mass | 426.07 |
| IUPAC Name | 2,6-dichloro-N-[3-(methoxymethyl)-4-pyrazol-1-ylquinolin-8-yl]benzamide |
| SMILES | COCc1cnc2c(NC(=O)c3c(Cl)cccc3Cl)cccc2c1-n1cccn1 |
| InChI | InChI=1S/C21H16Cl2N4O2/c1-29-12-13-11-24-19-14(20(13)27-10-4-9-25-27)5-2-8-17(19)26-21(28)18-15(22)6-3-7-16(18)23/h2-11H,12H2,1H3,(H,26,28) |
| InChIKey | ORTYRCKWPIWPOP-UHFFFAOYSA-N |
| XLogP | 5.13 |
| TPSA | 69.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.29 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |