C19H18Cl2N4O — CID 19592896
N-[4-(3-aminopropylamino)quinolin-8-yl]-2,6-dichlorobenzamide (PubChem CID 19592896) has the molecular formula C19H18Cl2N4O and a molecular weight of 389.29 g/mol. Its IUPAC name is N-[4-(3-aminopropylamino)quinolin-8-yl]-2,6-dichlorobenzamide.
| Compound Name | N-[4-(3-aminopropylamino)quinolin-8-yl]-2,6-dichlorobenzamide |
|---|---|
| PubChem CID | 19592896 |
| Molecular Formula | C19H18Cl2N4O |
| Molecular Weight | 389.29 g/mol |
| Exact Mass | 388.09 |
| IUPAC Name | N-[4-(3-aminopropylamino)quinolin-8-yl]-2,6-dichlorobenzamide |
| SMILES | NCCCNc1ccnc2c(NC(=O)c3c(Cl)cccc3Cl)cccc12 |
| InChI | InChI=1S/C19H18Cl2N4O/c20-13-5-2-6-14(21)17(13)19(26)25-16-7-1-4-12-15(23-10-3-9-22)8-11-24-18(12)16/h1-2,4-8,11H,3,9-10,22H2,(H,23,24)(H,25,26) |
| InChIKey | VJXHHOPBSUACSJ-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 80.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.29 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|