C19H17Cl3N4O — CID 19592429
2,6-dichloro-N-[6-chloro-4-[2-(methylamino)ethylamino]quinolin-8-yl]benzamide (PubChem CID 19592429) has the molecular formula C19H17Cl3N4O and a molecular weight of 423.73 g/mol. Its IUPAC name is 2,6-dichloro-N-[6-chloro-4-[2-(methylamino)ethylamino]quinolin-8-yl]benzamide.
| Compound Name | 2,6-dichloro-N-[6-chloro-4-[2-(methylamino)ethylamino]quinolin-8-yl]benzamide |
|---|---|
| PubChem CID | 19592429 |
| Molecular Formula | C19H17Cl3N4O |
| Molecular Weight | 423.73 g/mol |
| Exact Mass | 422.05 |
| IUPAC Name | 2,6-dichloro-N-[6-chloro-4-[2-(methylamino)ethylamino]quinolin-8-yl]benzamide |
| SMILES | CNCCNc1ccnc2c(NC(=O)c3c(Cl)cccc3Cl)cc(Cl)cc12 |
| InChI | InChI=1S/C19H17Cl3N4O/c1-23-7-8-24-15-5-6-25-18-12(15)9-11(20)10-16(18)26-19(27)17-13(21)3-2-4-14(17)22/h2-6,9-10,23H,7-8H2,1H3,(H,24,25)(H,26,27) |
| InChIKey | YOBZTWIOXFJYFX-UHFFFAOYSA-N |
| XLogP | 5.08 |
| TPSA | 66.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.73 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|