C19H13Cl2F3N4O2 — CID 19592393
N-[4-(2-acetylhydrazinyl)-6-(trifluoromethyl)quinolin-8-yl]-2,6-dichlorobenzamide (PubChem CID 19592393) has the molecular formula C19H13Cl2F3N4O2 and a molecular weight of 457.24 g/mol. Its IUPAC name is N-[4-(2-acetylhydrazinyl)-6-(trifluoromethyl)quinolin-8-yl]-2,6-dichlorobenzamide.
| Compound Name | N-[4-(2-acetylhydrazinyl)-6-(trifluoromethyl)quinolin-8-yl]-2,6-dichlorobenzamide |
|---|---|
| PubChem CID | 19592393 |
| Molecular Formula | C19H13Cl2F3N4O2 |
| Molecular Weight | 457.24 g/mol |
| Exact Mass | 456.04 |
| IUPAC Name | N-[4-(2-acetylhydrazinyl)-6-(trifluoromethyl)quinolin-8-yl]-2,6-dichlorobenzamide |
| SMILES | CC(=O)NNc1ccnc2c(NC(=O)c3c(Cl)cccc3Cl)cc(C(F)(F)F)cc12 |
| InChI | InChI=1S/C19H13Cl2F3N4O2/c1-9(29)27-28-14-5-6-25-17-11(14)7-10(19(22,23)24)8-15(17)26-18(30)16-12(20)3-2-4-13(16)21/h2-8H,1H3,(H,25,28)(H,26,30)(H,27,29) |
| InChIKey | OZVCJEURSRLBOK-UHFFFAOYSA-N |
| XLogP | 5.28 |
| TPSA | 83.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.24 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|