C20H18Cl2N2O3 — CID 139782319
2,6-dichloro-N-[4-(2-methoxyethoxy)-2-methylquinolin-8-yl]benzamide (PubChem CID 139782319) has the molecular formula C20H18Cl2N2O3 and a molecular weight of 405.28 g/mol. Its IUPAC name is 2,6-dichloro-N-[4-(2-methoxyethoxy)-2-methylquinolin-8-yl]benzamide.
| Compound Name | 2,6-dichloro-N-[4-(2-methoxyethoxy)-2-methylquinolin-8-yl]benzamide |
|---|---|
| PubChem CID | 139782319 |
| Molecular Formula | C20H18Cl2N2O3 |
| Molecular Weight | 405.28 g/mol |
| Exact Mass | 404.07 |
| IUPAC Name | 2,6-dichloro-N-[4-(2-methoxyethoxy)-2-methylquinolin-8-yl]benzamide |
| SMILES | COCCOc1cc(C)nc2c(NC(=O)c3c(Cl)cccc3Cl)cccc12 |
| InChI | InChI=1S/C20H18Cl2N2O3/c1-12-11-17(27-10-9-26-2)13-5-3-8-16(19(13)23-12)24-20(25)18-14(21)6-4-7-15(18)22/h3-8,11H,9-10H2,1-2H3,(H,24,25) |
| InChIKey | OWKKLSAXEHOOPU-UHFFFAOYSA-N |
| XLogP | 5.13 |
| TPSA | 60.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.28 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|