C20H24BrN5O2 — CID 142996291
1-[3-[(E)-2-bromo-1-[methyl-(methylideneamino)amino]ethenyl]-4-methoxyphenyl]-3-[4-(dimethylamino)phenyl]urea (PubChem CID 142996291) has the molecular formula C20H24BrN5O2 and a molecular weight of 446.35 g/mol. Its IUPAC name is 1-[3-[(E)-2-bromo-1-[methyl-(methylideneamino)amino]ethenyl]-4-methoxyphenyl]-3-[4-(dimethylamino)phenyl]urea.
| Compound Name | 1-[3-[(E)-2-bromo-1-[methyl-(methylideneamino)amino]ethenyl]-4-methoxyphenyl]-3-[4-(dimethylamino)phenyl]urea |
|---|---|
| PubChem CID | 142996291 |
| Molecular Formula | C20H24BrN5O2 |
| Molecular Weight | 446.35 g/mol |
| Exact Mass | 445.11 |
| IUPAC Name | 1-[3-[(E)-2-bromo-1-[methyl-(methylideneamino)amino]ethenyl]-4-methoxyphenyl]-3-[4-(dimethylamino)phenyl]urea |
| SMILES | C=NN(C)/C(=C/Br)c1cc(NC(=O)Nc2ccc(N(C)C)cc2)ccc1OC |
| InChI | InChI=1S/C20H24BrN5O2/c1-22-26(4)18(13-21)17-12-15(8-11-19(17)28-5)24-20(27)23-14-6-9-16(10-7-14)25(2)3/h6-13H,1H2,2-5H3,(H2,23,24,27)/b18-13+ |
| InChIKey | XETHGESQNBPUJQ-QGOAFFKASA-N |
| XLogP | 4.65 |
| TPSA | 69.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.35 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|