C18H24FN7 — CID 142996629
(2E)-2-fluoropenta-2,4-dien-1-imine;7-(imidazol-1-ylmethyl)-3-methyl-8-propyl-2,3-dihydro-[1,2,4]triazolo[4,3-c]pyrimidine (PubChem CID 142996629) has the molecular formula C18H24FN7 and a molecular weight of 357.44 g/mol. Its IUPAC name is (2E)-2-fluoropenta-2,4-dien-1-imine;7-(imidazol-1-ylmethyl)-3-methyl-8-propyl-2,3-dihydro-[1,2,4]triazolo[4,3-c]pyrimidine.
| Compound Name | (2E)-2-fluoropenta-2,4-dien-1-imine;7-(imidazol-1-ylmethyl)-3-methyl-8-propyl-2,3-dihydro-[1,2,4]triazolo[4,3-c]pyrimidine |
|---|---|
| PubChem CID | 142996629 |
| Molecular Formula | C18H24FN7 |
| Molecular Weight | 357.44 g/mol |
| Exact Mass | 357.21 |
| IUPAC Name | (2E)-2-fluoropenta-2,4-dien-1-imine;7-(imidazol-1-ylmethyl)-3-methyl-8-propyl-2,3-dihydro-[1,2,4]triazolo[4,3-c]pyrimidine |
| SMILES | CCCC1=C(Cn2ccnc2)N=CN2C1=NNC2C.[H]/N=C/C(F)=C\C=C |
| InChI | InChI=1S/C13H18N6.C5H6FN/c1-3-4-11-12(7-18-6-5-14-8-18)15-9-19-10(2)16-17-13(11)19;1-2-3-5(6)4-7/h5-6,8-10,16H,3-4,7H2,1-2H3;2-4,7H,1H2/b;5-3+,7-4+ |
| InChIKey | TUHUMBLVLWTLSN-ASOYATJJSA-N |
| XLogP | 3.22 |
| TPSA | 81.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.44 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|