C21H26F2N6 — CID 142996740
N'-[7-[[2-[(4,7-difluorocyclohepta-1,4,6-trien-1-yl)methyl]imidazol-1-yl]methyl]-6-ethyl-4,5-dihydro-1,3-diazepin-3-yl]ethanimidamide (PubChem CID 142996740) has the molecular formula C21H26F2N6 and a molecular weight of 400.48 g/mol. Its IUPAC name is N'-[7-[[2-[(4,7-difluorocyclohepta-1,4,6-trien-1-yl)methyl]imidazol-1-yl]methyl]-6-ethyl-4,5-dihydro-1,3-diazepin-3-yl]ethanimidamide.
| Compound Name | N'-[7-[[2-[(4,7-difluorocyclohepta-1,4,6-trien-1-yl)methyl]imidazol-1-yl]methyl]-6-ethyl-4,5-dihydro-1,3-diazepin-3-yl]ethanimidamide |
|---|---|
| PubChem CID | 142996740 |
| Molecular Formula | C21H26F2N6 |
| Molecular Weight | 400.48 g/mol |
| Exact Mass | 400.22 |
| IUPAC Name | N'-[7-[[2-[(4,7-difluorocyclohepta-1,4,6-trien-1-yl)methyl]imidazol-1-yl]methyl]-6-ethyl-4,5-dihydro-1,3-diazepin-3-yl]ethanimidamide |
| SMILES | CCC1=C(Cn2ccnc2CC2=CCC(F)=CC=C2F)N=CN(/N=C(/C)N)CC1 |
| InChI | InChI=1S/C21H26F2N6/c1-3-16-8-10-29(27-15(2)24)14-26-20(16)13-28-11-9-25-21(28)12-17-4-5-18(22)6-7-19(17)23/h4,6-7,9,11,14H,3,5,8,10,12-13H2,1-2H3,(H2,24,27) |
| InChIKey | FPOZLQURVFDTMX-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 71.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.48 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|