C18H22FN7 — CID 142996617
[6-[[2-[(E)-4-cyanobut-3-enyl]imidazol-1-yl]methyl]-5-(3-fluoropropyl)-4H-pyrimidin-3-yl]-methylcyanamide (PubChem CID 142996617) has the molecular formula C18H22FN7 and a molecular weight of 355.42 g/mol. Its IUPAC name is [6-[[2-[(E)-4-cyanobut-3-enyl]imidazol-1-yl]methyl]-5-(3-fluoropropyl)-4H-pyrimidin-3-yl]-methylcyanamide.
| Compound Name | [6-[[2-[(E)-4-cyanobut-3-enyl]imidazol-1-yl]methyl]-5-(3-fluoropropyl)-4H-pyrimidin-3-yl]-methylcyanamide |
|---|---|
| PubChem CID | 142996617 |
| Molecular Formula | C18H22FN7 |
| Molecular Weight | 355.42 g/mol |
| Exact Mass | 355.19 |
| IUPAC Name | [6-[[2-[(E)-4-cyanobut-3-enyl]imidazol-1-yl]methyl]-5-(3-fluoropropyl)-4H-pyrimidin-3-yl]-methylcyanamide |
| SMILES | CN(C#N)N1C=NC(Cn2ccnc2CC/C=C/C#N)=C(CCCF)C1 |
| InChI | InChI=1S/C18H22FN7/c1-24(14-21)26-12-16(6-5-8-19)17(23-15-26)13-25-11-10-22-18(25)7-3-2-4-9-20/h2,4,10-11,15H,3,5-8,12-13H2,1H3/b4-2+ |
| InChIKey | BNOOQXDVSAHPPP-DUXPYHPUSA-N |
| XLogP | 2.57 |
| TPSA | 84.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.42 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'} |
|---|