C18H26N2Y — CID 134838136
1,3-ditert-butyl-2-(phenylmethyl)imidazol-1-ium;yttrium (PubChem CID 134838136) has the molecular formula C18H26N2Y and a molecular weight of 359.33 g/mol. Its IUPAC name is 1,3-ditert-butyl-2-(phenylmethyl)imidazol-1-ium;yttrium.
| Compound Name | 1,3-ditert-butyl-2-(phenylmethyl)imidazol-1-ium;yttrium |
|---|---|
| PubChem CID | 134838136 |
| Molecular Formula | C18H26N2Y |
| Molecular Weight | 359.33 g/mol |
| Exact Mass | 359.12 |
| IUPAC Name | 1,3-ditert-butyl-2-(phenylmethyl)imidazol-1-ium;yttrium |
| SMILES | CC(C)(C)n1cc[n+](C(C)(C)C)c1Cc1cc[c-]cc1.[Y] |
| InChI | InChI=1S/C18H26N2.Y/c1-17(2,3)19-12-13-20(18(4,5)6)16(19)14-15-10-8-7-9-11-15;/h8-13H,14H2,1-6H3; |
| InChIKey | HMAYZCQOUOQZMC-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 8.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.33 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|