C12H14F2N2 — CID 143913734
2-[(3E)-4-fluoro-3-(1-fluoroethenyl)hexa-3,5-dien-2-yl]-1-methylimidazole (PubChem CID 143913734) has the molecular formula C12H14F2N2 and a molecular weight of 224.25 g/mol. Its IUPAC name is 2-[(3E)-4-fluoro-3-(1-fluoroethenyl)hexa-3,5-dien-2-yl]-1-methylimidazole.
| Compound Name | 2-[(3E)-4-fluoro-3-(1-fluoroethenyl)hexa-3,5-dien-2-yl]-1-methylimidazole |
|---|---|
| PubChem CID | 143913734 |
| Molecular Formula | C12H14F2N2 |
| Molecular Weight | 224.25 g/mol |
| Exact Mass | 224.11 |
| IUPAC Name | 2-[(3E)-4-fluoro-3-(1-fluoroethenyl)hexa-3,5-dien-2-yl]-1-methylimidazole |
| SMILES | C=C/C(F)=C(\C(=C)F)C(C)c1nccn1C |
| InChI | InChI=1S/C12H14F2N2/c1-5-10(14)11(9(3)13)8(2)12-15-6-7-16(12)4/h5-8H,1,3H2,2,4H3/b11-10+ |
| InChIKey | DNXLXWUIFOCCBW-ZHACJKMWSA-N |
| XLogP | 3.42 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.25 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|