C12H7F6IrN2- — CID 58769473
2-[3,5-bis(trifluoromethyl)benzene-6-id-1-yl]-1-methylimidazole;iridium (PubChem CID 58769473) has the molecular formula C12H7F6IrN2- and a molecular weight of 485.41 g/mol. Its IUPAC name is 2-[3,5-bis(trifluoromethyl)benzene-6-id-1-yl]-1-methylimidazole;iridium.
| Compound Name | 2-[3,5-bis(trifluoromethyl)benzene-6-id-1-yl]-1-methylimidazole;iridium |
|---|---|
| PubChem CID | 58769473 |
| Molecular Formula | C12H7F6IrN2- |
| Molecular Weight | 485.41 g/mol |
| Exact Mass | 486.01 |
| IUPAC Name | 2-[3,5-bis(trifluoromethyl)benzene-6-id-1-yl]-1-methylimidazole;iridium |
| SMILES | Cn1ccnc1-c1[c-]c(C(F)(F)F)cc(C(F)(F)F)c1.[Ir] |
| InChI | InChI=1S/C12H7F6N2.Ir/c1-20-3-2-19-10(20)7-4-8(11(13,14)15)6-9(5-7)12(16,17)18;/h2-4,6H,1H3;/q-1; |
| InChIKey | ASDGKEZSRGQKPS-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.41 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|