C24H20F6N4Pt — CID 59661470
bis(2-(2-methylbenzene-6-id-1-yl)-1-(2,2,2-trifluoroethyl)imidazole);platinum(2+) (PubChem CID 59661470) has the molecular formula C24H20F6N4Pt and a molecular weight of 673.52 g/mol. Its IUPAC name is bis(2-(2-methylbenzene-6-id-1-yl)-1-(2,2,2-trifluoroethyl)imidazole);platinum(2+).
| Compound Name | bis(2-(2-methylbenzene-6-id-1-yl)-1-(2,2,2-trifluoroethyl)imidazole);platinum(2+) |
|---|---|
| PubChem CID | 59661470 |
| Molecular Formula | C24H20F6N4Pt |
| Molecular Weight | 673.52 g/mol |
| Exact Mass | 673.12 |
| IUPAC Name | bis(2-(2-methylbenzene-6-id-1-yl)-1-(2,2,2-trifluoroethyl)imidazole);platinum(2+) |
| SMILES | Cc1ccc[c-]c1-c1nccn1CC(F)(F)F.Cc1ccc[c-]c1-c1nccn1CC(F)(F)F.[Pt+2] |
| InChI | InChI=1S/2C12H10F3N2.Pt/c2*1-9-4-2-3-5-10(9)11-16-6-7-17(11)8-12(13,14)15;/h2*2-4,6-7H,8H2,1H3;/q2*-1;+2 |
| InChIKey | CAIGHJFISVGHSK-UHFFFAOYSA-N |
| XLogP | 6.44 |
| TPSA | 35.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 673.52 |
| LogP ≤ 5 | 6.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|